C25H47BO3Si — CID 56593722
[(Z,4R)-4-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]pent-2-enoxy]-triethylsilane (PubChem CID 56593722) has the molecular formula C25H47BO3Si and a molecular weight of 434.55 g/mol. Its IUPAC name is [(Z,4R)-4-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]pent-2-enoxy]-triethylsilane.
| Compound Name | [(Z,4R)-4-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]pent-2-enoxy]-triethylsilane |
|---|---|
| PubChem CID | 56593722 |
| Molecular Formula | C25H47BO3Si |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.34 |
| IUPAC Name | [(Z,4R)-4-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]pent-2-enoxy]-triethylsilane |
| SMILES | CC[Si](CC)(CC)OC/C=C\[C@@H](C)B1O[C@H](C2CCCCC2)[C@@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C25H47BO3Si/c1-5-30(6-2,7-3)27-20-14-15-21(4)26-28-24(22-16-10-8-11-17-22)25(29-26)23-18-12-9-13-19-23/h14-15,21-25H,5-13,16-20H2,1-4H3/b15-14-/t21-,24-,25-/m1/s1 |
| InChIKey | DFTKIDIKFDFWSB-BHYIICQYSA-N |
| XLogP | 7.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|