C19H33BO2 — CID 10935585
(4R,5R)-4,5-dicyclohexyl-2-[(Z,2R)-pent-3-en-2-yl]-1,3,2-dioxaborolane (PubChem CID 10935585) has the molecular formula C19H33BO2 and a molecular weight of 304.28 g/mol. Its IUPAC name is (4R,5R)-4,5-dicyclohexyl-2-[(Z,2R)-pent-3-en-2-yl]-1,3,2-dioxaborolane.
| Compound Name | (4R,5R)-4,5-dicyclohexyl-2-[(Z,2R)-pent-3-en-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 10935585 |
| Molecular Formula | C19H33BO2 |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.26 |
| IUPAC Name | (4R,5R)-4,5-dicyclohexyl-2-[(Z,2R)-pent-3-en-2-yl]-1,3,2-dioxaborolane |
| SMILES | C/C=C\[C@@H](C)B1O[C@H](C2CCCCC2)[C@@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C19H33BO2/c1-3-10-15(2)20-21-18(16-11-6-4-7-12-16)19(22-20)17-13-8-5-9-14-17/h3,10,15-19H,4-9,11-14H2,1-2H3/b10-3-/t15-,18-,19-/m1/s1 |
| InChIKey | WORKFSGBXDTXHW-LZUKCBHXSA-N |
| XLogP | 5.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|