C21H37BClO2- — CID 134840991
trans-(4R,5R)-2-(chloromethyl)-4,5-dicyclohexyl-2-[(2R)-3-methylidenepentan-2-yl]-1,3-dioxa-2-boranuidacyclopentane (PubChem CID 134840991) has the molecular formula C21H37BClO2- and a molecular weight of 367.79 g/mol. Its IUPAC name is trans-(4R,5R)-2-(chloromethyl)-4,5-dicyclohexyl-2-[(2R)-3-methylidenepentan-2-yl]-1,3-dioxa-2-boranuidacyclopentane.
| Compound Name | trans-(4R,5R)-2-(chloromethyl)-4,5-dicyclohexyl-2-[(2R)-3-methylidenepentan-2-yl]-1,3-dioxa-2-boranuidacyclopentane |
|---|---|
| PubChem CID | 134840991 |
| Molecular Formula | C21H37BClO2- |
| Molecular Weight | 367.79 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | trans-(4R,5R)-2-(chloromethyl)-4,5-dicyclohexyl-2-[(2R)-3-methylidenepentan-2-yl]-1,3-dioxa-2-boranuidacyclopentane |
| SMILES | C=C(CC)[C@@H](C)[B-]1(CCl)O[C@H](C2CCCCC2)[C@@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C21H37BClO2/c1-4-16(2)17(3)22(15-23)24-20(18-11-7-5-8-12-18)21(25-22)19-13-9-6-10-14-19/h17-21H,2,4-15H2,1,3H3/q-1/t17-,20-,21-/m1/s1 |
| InChIKey | LQEGOQRDRPQHFG-DUXKGJEZSA-N |
| XLogP | 6.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.79 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|