C22H38BClO2 — CID 15378488
(4R,5R)-2-[(1S,3S)-1-chloro-3-methyl-4-methylidenehexyl]-4,5-dicyclohexyl-1,3,2-dioxaborolane (PubChem CID 15378488) has the molecular formula C22H38BClO2 and a molecular weight of 380.81 g/mol. Its IUPAC name is (4R,5R)-2-[(1S,3S)-1-chloro-3-methyl-4-methylidenehexyl]-4,5-dicyclohexyl-1,3,2-dioxaborolane.
| Compound Name | (4R,5R)-2-[(1S,3S)-1-chloro-3-methyl-4-methylidenehexyl]-4,5-dicyclohexyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 15378488 |
| Molecular Formula | C22H38BClO2 |
| Molecular Weight | 380.81 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | (4R,5R)-2-[(1S,3S)-1-chloro-3-methyl-4-methylidenehexyl]-4,5-dicyclohexyl-1,3,2-dioxaborolane |
| SMILES | C=C(CC)[C@@H](C)C[C@@H](Cl)B1O[C@H](C2CCCCC2)[C@@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C22H38BClO2/c1-4-16(2)17(3)15-20(24)23-25-21(18-11-7-5-8-12-18)22(26-23)19-13-9-6-10-14-19/h17-22H,2,4-15H2,1,3H3/t17-,20+,21+,22+/m0/s1 |
| InChIKey | VTCZIJKDNPTAER-ZHNGQKSSSA-N |
| XLogP | 6.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.81 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|