C26H47BO2 — CID 10763629
(4R,5R)-4,5-dicyclohexyl-2-[(3S,4S,6S)-4,6-dimethyl-7-methylidenenonan-3-yl]-1,3,2-dioxaborolane (PubChem CID 10763629) has the molecular formula C26H47BO2 and a molecular weight of 402.47 g/mol. Its IUPAC name is (4R,5R)-4,5-dicyclohexyl-2-[(3S,4S,6S)-4,6-dimethyl-7-methylidenenonan-3-yl]-1,3,2-dioxaborolane.
| Compound Name | (4R,5R)-4,5-dicyclohexyl-2-[(3S,4S,6S)-4,6-dimethyl-7-methylidenenonan-3-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 10763629 |
| Molecular Formula | C26H47BO2 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.37 |
| IUPAC Name | (4R,5R)-4,5-dicyclohexyl-2-[(3S,4S,6S)-4,6-dimethyl-7-methylidenenonan-3-yl]-1,3,2-dioxaborolane |
| SMILES | C=C(CC)[C@@H](C)C[C@H](C)[C@H](CC)B1O[C@H](C2CCCCC2)[C@@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C26H47BO2/c1-6-19(3)20(4)18-21(5)24(7-2)27-28-25(22-14-10-8-11-15-22)26(29-27)23-16-12-9-13-17-23/h20-26H,3,6-18H2,1-2,4-5H3/t20-,21-,24-,25+,26+/m0/s1 |
| InChIKey | VBKATSDQNRLNDX-XEJWYGKLSA-N |
| XLogP | 7.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|