C21H37BO2 — CID 10544534
(4R,5R)-4,5-dicyclohexyl-2-[(2S)-2-methyl-3-methylidenepentyl]-1,3,2-dioxaborolane (PubChem CID 10544534) has the molecular formula C21H37BO2 and a molecular weight of 332.34 g/mol. Its IUPAC name is (4R,5R)-4,5-dicyclohexyl-2-[(2S)-2-methyl-3-methylidenepentyl]-1,3,2-dioxaborolane.
| Compound Name | (4R,5R)-4,5-dicyclohexyl-2-[(2S)-2-methyl-3-methylidenepentyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 10544534 |
| Molecular Formula | C21H37BO2 |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.29 |
| IUPAC Name | (4R,5R)-4,5-dicyclohexyl-2-[(2S)-2-methyl-3-methylidenepentyl]-1,3,2-dioxaborolane |
| SMILES | C=C(CC)[C@@H](C)CB1O[C@H](C2CCCCC2)[C@@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C21H37BO2/c1-4-16(2)17(3)15-22-23-20(18-11-7-5-8-12-18)21(24-22)19-13-9-6-10-14-19/h17-21H,2,4-15H2,1,3H3/t17-,20+,21+/m0/s1 |
| InChIKey | RGKPYEYJTAXEHI-IOMROCGXSA-N |
| XLogP | 6.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|