C20H35BO2 — CID 10567537
(4R,5R)-4,5-dicyclohexyl-2-[(2R)-3-methylidenepentan-2-yl]-1,3,2-dioxaborolane (PubChem CID 10567537) has the molecular formula C20H35BO2 and a molecular weight of 318.31 g/mol. Its IUPAC name is (4R,5R)-4,5-dicyclohexyl-2-[(2R)-3-methylidenepentan-2-yl]-1,3,2-dioxaborolane.
| Compound Name | (4R,5R)-4,5-dicyclohexyl-2-[(2R)-3-methylidenepentan-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 10567537 |
| Molecular Formula | C20H35BO2 |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.27 |
| IUPAC Name | (4R,5R)-4,5-dicyclohexyl-2-[(2R)-3-methylidenepentan-2-yl]-1,3,2-dioxaborolane |
| SMILES | C=C(CC)[C@@H](C)B1O[C@H](C2CCCCC2)[C@@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C20H35BO2/c1-4-15(2)16(3)21-22-19(17-11-7-5-8-12-17)20(23-21)18-13-9-6-10-14-18/h16-20H,2,4-14H2,1,3H3/t16-,19-,20-/m1/s1 |
| InChIKey | FJOIHQIZODUDJC-NSISKUIASA-N |
| XLogP | 5.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|