C23H41BO2 — CID 15083767
(4S,5S)-4,5-dicyclohexyl-2-[(Z,2S)-4-methyloct-3-en-2-yl]-1,3,2-dioxaborolane (PubChem CID 15083767) has the molecular formula C23H41BO2 and a molecular weight of 360.39 g/mol. Its IUPAC name is (4S,5S)-4,5-dicyclohexyl-2-[(Z,2S)-4-methyloct-3-en-2-yl]-1,3,2-dioxaborolane.
| Compound Name | (4S,5S)-4,5-dicyclohexyl-2-[(Z,2S)-4-methyloct-3-en-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 15083767 |
| Molecular Formula | C23H41BO2 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.32 |
| IUPAC Name | (4S,5S)-4,5-dicyclohexyl-2-[(Z,2S)-4-methyloct-3-en-2-yl]-1,3,2-dioxaborolane |
| SMILES | CCCC/C(C)=C\[C@H](C)B1O[C@@H](C2CCCCC2)[C@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C23H41BO2/c1-4-5-12-18(2)17-19(3)24-25-22(20-13-8-6-9-14-20)23(26-24)21-15-10-7-11-16-21/h17,19-23H,4-16H2,1-3H3/b18-17-/t19-,22-,23-/m0/s1 |
| InChIKey | TWQXQEOXQUZWJH-TXUZLTTFSA-N |
| XLogP | 6.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|