C24H42BClO2 — CID 85199645
2-(1-chloro-2,4-dimethyl-5-methylideneheptyl)-4,5-dicyclohexyl-1,3,2-dioxaborolane (PubChem CID 85199645) has the molecular formula C24H42BClO2 and a molecular weight of 408.86 g/mol. Its IUPAC name is 2-(1-chloro-2,4-dimethyl-5-methylideneheptyl)-4,5-dicyclohexyl-1,3,2-dioxaborolane.
| Compound Name | 2-(1-chloro-2,4-dimethyl-5-methylideneheptyl)-4,5-dicyclohexyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 85199645 |
| Molecular Formula | C24H42BClO2 |
| Molecular Weight | 408.86 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | 2-(1-chloro-2,4-dimethyl-5-methylideneheptyl)-4,5-dicyclohexyl-1,3,2-dioxaborolane |
| SMILES | C=C(CC)C(C)CC(C)C(Cl)B1OC(C2CCCCC2)C(C2CCCCC2)O1 |
| InChI | InChI=1S/C24H42BClO2/c1-5-17(2)18(3)16-19(4)24(26)25-27-22(20-12-8-6-9-13-20)23(28-25)21-14-10-7-11-15-21/h18-24H,2,5-16H2,1,3-4H3 |
| InChIKey | PHVDYBMFSURFIR-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.86 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|