C21H41BO2Si — CID 134904643
tert-butyl-[[(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]methyl]-dimethylsilane (PubChem CID 134904643) has the molecular formula C21H41BO2Si and a molecular weight of 364.46 g/mol. Its IUPAC name is tert-butyl-[[(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]methyl]-dimethylsilane.
| Compound Name | tert-butyl-[[(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]methyl]-dimethylsilane |
|---|---|
| PubChem CID | 134904643 |
| Molecular Formula | C21H41BO2Si |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.30 |
| IUPAC Name | tert-butyl-[[(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]methyl]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)CB1O[C@@H](C2CCCCC2)[C@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C21H41BO2Si/c1-21(2,3)25(4,5)16-22-23-19(17-12-8-6-9-13-17)20(24-22)18-14-10-7-11-15-18/h17-20H,6-16H2,1-5H3/t19-,20-/m0/s1 |
| InChIKey | JHLCNOKWEZQQKR-PMACEKPBSA-N |
| XLogP | 6.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|