C22H42BClO3Si — CID 10598658
tert-butyl-[(2R)-2-chloro-2-[(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]ethoxy]-dimethylsilane (PubChem CID 10598658) has the molecular formula C22H42BClO3Si and a molecular weight of 428.93 g/mol. Its IUPAC name is tert-butyl-[(2R)-2-chloro-2-[(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R)-2-chloro-2-[(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10598658 |
| Molecular Formula | C22H42BClO3Si |
| Molecular Weight | 428.93 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | tert-butyl-[(2R)-2-chloro-2-[(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]ethoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](Cl)B1O[C@@H](C2CCCCC2)[C@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C22H42BClO3Si/c1-22(2,3)28(4,5)25-16-19(24)23-26-20(17-12-8-6-9-13-17)21(27-23)18-14-10-7-11-15-18/h17-21H,6-16H2,1-5H3/t19-,20-,21-/m0/s1 |
| InChIKey | ARWWOYLJTLPZNV-ACRUOGEOSA-N |
| XLogP | 6.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.93 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|