C25H45BClNO3Si — CID 135048343
(4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-chloro-5-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]pentanenitrile (PubChem CID 135048343) has the molecular formula C25H45BClNO3Si and a molecular weight of 481.99 g/mol. Its IUPAC name is (4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-chloro-5-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]pentanenitrile.
| Compound Name | (4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-chloro-5-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]pentanenitrile |
|---|---|
| PubChem CID | 135048343 |
| Molecular Formula | C25H45BClNO3Si |
| Molecular Weight | 481.99 g/mol |
| Exact Mass | 481.30 |
| IUPAC Name | (4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-chloro-5-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]pentanenitrile |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CCC#N)C(Cl)B1O[C@H](C2CCCCC2)[C@@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C25H45BClNO3Si/c1-25(2,3)32(4,5)31-21(17-12-18-28)24(27)26-29-22(19-13-8-6-9-14-19)23(30-26)20-15-10-7-11-16-20/h19-24H,6-17H2,1-5H3/t21-,22+,23+,24?/m0/s1 |
| InChIKey | RKWMWOFLAWJHFO-DVZSQSHLSA-N |
| XLogP | 7.26 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.99 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|