C18H29BClNO2 — CID 135082464
(4S)-4-chloro-4-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]butanenitrile (PubChem CID 135082464) has the molecular formula C18H29BClNO2 and a molecular weight of 337.70 g/mol. Its IUPAC name is (4S)-4-chloro-4-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]butanenitrile.
| Compound Name | (4S)-4-chloro-4-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]butanenitrile |
|---|---|
| PubChem CID | 135082464 |
| Molecular Formula | C18H29BClNO2 |
| Molecular Weight | 337.70 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | (4S)-4-chloro-4-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]butanenitrile |
| SMILES | N#CCC[C@@H](Cl)B1O[C@H](C2CCCCC2)[C@@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C18H29BClNO2/c20-16(12-7-13-21)19-22-17(14-8-3-1-4-9-14)18(23-19)15-10-5-2-6-11-15/h14-18H,1-12H2/t16-,17-,18-/m1/s1 |
| InChIKey | MFUQNDBXVQYHII-KZNAEPCWSA-N |
| XLogP | 4.87 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.70 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|