C27H49BClNO3Si — CID 11049478
(5S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-chloro-5-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]pentanenitrile (PubChem CID 11049478) has the molecular formula C27H49BClNO3Si and a molecular weight of 510.04 g/mol. Its IUPAC name is (5S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-chloro-5-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]pentanenitrile.
| Compound Name | (5S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-chloro-5-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]pentanenitrile |
|---|---|
| PubChem CID | 11049478 |
| Molecular Formula | C27H49BClNO3Si |
| Molecular Weight | 510.04 g/mol |
| Exact Mass | 509.33 |
| IUPAC Name | (5S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-chloro-5-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]pentanenitrile |
| SMILES | CC(C)(C)[Si](C)(C)OCCC(C#N)CC[C@@H](Cl)B1O[C@H](C2CCCCC2)[C@@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C27H49BClNO3Si/c1-27(2,3)34(4,5)31-19-18-21(20-30)16-17-24(29)28-32-25(22-12-8-6-9-13-22)26(33-28)23-14-10-7-11-15-23/h21-26H,6-19H2,1-5H3/t21?,24-,25-,26-/m1/s1 |
| InChIKey | MKQSROVPOZIRCT-ZSZFIPSZSA-N |
| XLogP | 7.90 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.04 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|