C25H44BNO3Si — CID 134903384
(1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]cyclobutane-1-carbonitrile (PubChem CID 134903384) has the molecular formula C25H44BNO3Si and a molecular weight of 445.53 g/mol. Its IUPAC name is (1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]cyclobutane-1-carbonitrile.
| Compound Name | (1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]cyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 134903384 |
| Molecular Formula | C25H44BNO3Si |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.32 |
| IUPAC Name | (1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]cyclobutane-1-carbonitrile |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@@H](C#N)[C@@H]1B1O[C@H](C2CCCCC2)[C@@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C25H44BNO3Si/c1-25(2,3)31(4,5)30-21-16-20(17-27)22(21)26-28-23(18-12-8-6-9-13-18)24(29-26)19-14-10-7-11-15-19/h18-24H,6-16H2,1-5H3/t20-,21-,22-,23+,24+/m0/s1 |
| InChIKey | CMIPNHXMJHQGBT-ZROJVYTPSA-N |
| XLogP | 6.72 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|