C27H48BNO3Si — CID 11027137
cis-(1S,2R)-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]cyclobutane-1-carbonitrile (PubChem CID 11027137) has the molecular formula C27H48BNO3Si and a molecular weight of 473.58 g/mol. Its IUPAC name is cis-(1S,2R)-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]cyclobutane-1-carbonitrile.
| Compound Name | cis-(1S,2R)-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]cyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 11027137 |
| Molecular Formula | C27H48BNO3Si |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.35 |
| IUPAC Name | cis-(1S,2R)-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]cyclobutane-1-carbonitrile |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@@]1(C#N)CC[C@H]1B1O[C@H](C2CCCCC2)[C@@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C27H48BNO3Si/c1-26(2,3)33(4,5)30-19-18-27(20-29)17-16-23(27)28-31-24(21-12-8-6-9-13-21)25(32-28)22-14-10-7-11-15-22/h21-25H,6-19H2,1-5H3/t23-,24-,25-,27-/m1/s1 |
| InChIKey | DMNDISPBMVJXNW-DLGLWYJGSA-N |
| XLogP | 7.51 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|