C24H40BNO2 — CID 101044817
(1R,2R,3S)-3-butyl-2-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]-1-methylcyclobutane-1-carbonitrile (PubChem CID 101044817) has the molecular formula C24H40BNO2 and a molecular weight of 385.40 g/mol. Its IUPAC name is (1R,2R,3S)-3-butyl-2-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]-1-methylcyclobutane-1-carbonitrile.
| Compound Name | (1R,2R,3S)-3-butyl-2-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]-1-methylcyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 101044817 |
| Molecular Formula | C24H40BNO2 |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.32 |
| IUPAC Name | (1R,2R,3S)-3-butyl-2-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]-1-methylcyclobutane-1-carbonitrile |
| SMILES | CCCC[C@H]1C[C@@](C)(C#N)[C@@H]1B1O[C@H](C2CCCCC2)[C@@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C24H40BNO2/c1-3-4-11-20-16-24(2,17-26)23(20)25-27-21(18-12-7-5-8-13-18)22(28-25)19-14-9-6-10-15-19/h18-23H,3-16H2,1-2H3/t20-,21+,22+,23+,24-/m0/s1 |
| InChIKey | GILYYUUTIHIVCL-LSDVVMKASA-N |
| XLogP | 6.53 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|