C19H30BNO2 — CID 101044814
cis-(1R,2R)-2-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]cyclobutane-1-carbonitrile (PubChem CID 101044814) has the molecular formula C19H30BNO2 and a molecular weight of 315.27 g/mol. Its IUPAC name is cis-(1R,2R)-2-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]cyclobutane-1-carbonitrile.
| Compound Name | cis-(1R,2R)-2-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]cyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 101044814 |
| Molecular Formula | C19H30BNO2 |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | cis-(1R,2R)-2-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]cyclobutane-1-carbonitrile |
| SMILES | N#C[C@@H]1CC[C@H]1B1O[C@H](C2CCCCC2)[C@@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C19H30BNO2/c21-13-16-11-12-17(16)20-22-18(14-7-3-1-4-8-14)19(23-20)15-9-5-2-6-10-15/h14-19H,1-12H2/t16-,17+,18+,19+/m0/s1 |
| InChIKey | XAIGMOVVBHZTPG-WJFTUGDTSA-N |
| XLogP | 4.72 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|