C20H32BNO2 — CID 134854415
cis-(1R,2S)-2-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]-1-methylcyclobutane-1-carbonitrile (PubChem CID 134854415) has the molecular formula C20H32BNO2 and a molecular weight of 329.29 g/mol. Its IUPAC name is cis-(1R,2S)-2-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]-1-methylcyclobutane-1-carbonitrile.
| Compound Name | cis-(1R,2S)-2-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]-1-methylcyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 134854415 |
| Molecular Formula | C20H32BNO2 |
| Molecular Weight | 329.29 g/mol |
| Exact Mass | 329.25 |
| IUPAC Name | cis-(1R,2S)-2-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]-1-methylcyclobutane-1-carbonitrile |
| SMILES | C[C@@]1(C#N)CC[C@@H]1B1O[C@H](C2CCCCC2)[C@@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C20H32BNO2/c1-20(14-22)13-12-17(20)21-23-18(15-8-4-2-5-9-15)19(24-21)16-10-6-3-7-11-16/h15-19H,2-13H2,1H3/t17-,18+,19+,20-/m0/s1 |
| InChIKey | IHQACCQZENJGQE-NMLBUPMWSA-N |
| XLogP | 5.11 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.29 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|