C21H35BClNO2 — CID 135082572
(4R,5S)-5-chloro-5-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]-2,4-dimethylpentanenitrile (PubChem CID 135082572) has the molecular formula C21H35BClNO2 and a molecular weight of 379.78 g/mol. Its IUPAC name is (4R,5S)-5-chloro-5-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]-2,4-dimethylpentanenitrile.
| Compound Name | (4R,5S)-5-chloro-5-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]-2,4-dimethylpentanenitrile |
|---|---|
| PubChem CID | 135082572 |
| Molecular Formula | C21H35BClNO2 |
| Molecular Weight | 379.78 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | (4R,5S)-5-chloro-5-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]-2,4-dimethylpentanenitrile |
| SMILES | CC(C#N)C[C@@H](C)[C@@H](Cl)B1O[C@H](C2CCCCC2)[C@@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C21H35BClNO2/c1-15(14-24)13-16(2)21(23)22-25-19(17-9-5-3-6-10-17)20(26-22)18-11-7-4-8-12-18/h15-21H,3-13H2,1-2H3/t15?,16-,19-,20-,21-/m1/s1 |
| InChIKey | IMCDQILHSGKQNC-ITKDDASESA-N |
| XLogP | 5.75 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.78 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|