C19H31BClNO2 — CID 135082467
(4S)-4-chloro-4-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]-2-methylbutanenitrile (PubChem CID 135082467) has the molecular formula C19H31BClNO2 and a molecular weight of 351.73 g/mol. Its IUPAC name is (4S)-4-chloro-4-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]-2-methylbutanenitrile.
| Compound Name | (4S)-4-chloro-4-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]-2-methylbutanenitrile |
|---|---|
| PubChem CID | 135082467 |
| Molecular Formula | C19H31BClNO2 |
| Molecular Weight | 351.73 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | (4S)-4-chloro-4-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]-2-methylbutanenitrile |
| SMILES | CC(C#N)C[C@@H](Cl)B1O[C@H](C2CCCCC2)[C@@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C19H31BClNO2/c1-14(13-22)12-17(21)20-23-18(15-8-4-2-5-9-15)19(24-20)16-10-6-3-7-11-16/h14-19H,2-12H2,1H3/t14?,17-,18-,19-/m1/s1 |
| InChIKey | BWJJPDXXUYMHGQ-LEWXTWDNSA-N |
| XLogP | 5.12 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.73 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|