C17H30BClO2 — CID 15222423
(4R,5R)-2-[(1S)-1-chloropropyl]-4,5-dicyclohexyl-1,3,2-dioxaborolane (PubChem CID 15222423) has the molecular formula C17H30BClO2 and a molecular weight of 312.69 g/mol. Its IUPAC name is (4R,5R)-2-[(1S)-1-chloropropyl]-4,5-dicyclohexyl-1,3,2-dioxaborolane.
| Compound Name | (4R,5R)-2-[(1S)-1-chloropropyl]-4,5-dicyclohexyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 15222423 |
| Molecular Formula | C17H30BClO2 |
| Molecular Weight | 312.69 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | (4R,5R)-2-[(1S)-1-chloropropyl]-4,5-dicyclohexyl-1,3,2-dioxaborolane |
| SMILES | CC[C@@H](Cl)B1O[C@H](C2CCCCC2)[C@@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C17H30BClO2/c1-2-15(19)18-20-16(13-9-5-3-6-10-13)17(21-18)14-11-7-4-8-12-14/h13-17H,2-12H2,1H3/t15-,16-,17-/m1/s1 |
| InChIKey | CZFFGKAAKQTMOL-BRWVUGGUSA-N |
| XLogP | 4.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.69 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|