C15H25BCl2O2 — CID 15083765
(4S,5S)-4,5-dicyclohexyl-2-(dichloromethyl)-1,3,2-dioxaborolane (PubChem CID 15083765) has the molecular formula C15H25BCl2O2 and a molecular weight of 319.08 g/mol. Its IUPAC name is (4S,5S)-4,5-dicyclohexyl-2-(dichloromethyl)-1,3,2-dioxaborolane.
| Compound Name | (4S,5S)-4,5-dicyclohexyl-2-(dichloromethyl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 15083765 |
| Molecular Formula | C15H25BCl2O2 |
| Molecular Weight | 319.08 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | (4S,5S)-4,5-dicyclohexyl-2-(dichloromethyl)-1,3,2-dioxaborolane |
| SMILES | ClC(Cl)B1O[C@@H](C2CCCCC2)[C@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C15H25BCl2O2/c17-15(18)16-19-13(11-7-3-1-4-8-11)14(20-16)12-9-5-2-6-10-12/h11-15H,1-10H2/t13-,14-/m0/s1 |
| InChIKey | GPUXGMKOIOMPBF-KBPBESRZSA-N |
| XLogP | 4.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.08 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|