C15H26BClO2 — CID 135048242
(4S,5S)-2-(chloromethyl)-4,5-dicyclohexyl-1,3,2-dioxaborolane (PubChem CID 135048242) has the molecular formula C15H26BClO2 and a molecular weight of 284.64 g/mol. Its IUPAC name is (4S,5S)-2-(chloromethyl)-4,5-dicyclohexyl-1,3,2-dioxaborolane.
| Compound Name | (4S,5S)-2-(chloromethyl)-4,5-dicyclohexyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 135048242 |
| Molecular Formula | C15H26BClO2 |
| Molecular Weight | 284.64 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | (4S,5S)-2-(chloromethyl)-4,5-dicyclohexyl-1,3,2-dioxaborolane |
| SMILES | ClCB1O[C@@H](C2CCCCC2)[C@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C15H26BClO2/c17-11-16-18-14(12-7-3-1-4-8-12)15(19-16)13-9-5-2-6-10-13/h12-15H,1-11H2/t14-,15-/m0/s1 |
| InChIKey | IHPUKYQBRVFFBX-GJZGRUSLSA-N |
| XLogP | 4.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.64 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|