C15H27BO3 — CID 10563666
[(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]methanol (PubChem CID 10563666) has the molecular formula C15H27BO3 and a molecular weight of 266.19 g/mol. Its IUPAC name is [(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]methanol.
| Compound Name | [(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]methanol |
|---|---|
| PubChem CID | 10563666 |
| Molecular Formula | C15H27BO3 |
| Molecular Weight | 266.19 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | [(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]methanol |
| SMILES | OCB1O[C@@H](C2CCCCC2)[C@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C15H27BO3/c17-11-16-18-14(12-7-3-1-4-8-12)15(19-16)13-9-5-2-6-10-13/h12-15,17H,1-11H2/t14-,15-/m0/s1 |
| InChIKey | PPJGLJSSKPBCAK-GJZGRUSLSA-N |
| XLogP | 2.95 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.19 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|