C21H39BO3 — CID 15222422
(3S,4R,5S)-5-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]-4-methylhexan-3-ol (PubChem CID 15222422) has the molecular formula C21H39BO3 and a molecular weight of 350.35 g/mol. Its IUPAC name is (3S,4R,5S)-5-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]-4-methylhexan-3-ol.
| Compound Name | (3S,4R,5S)-5-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]-4-methylhexan-3-ol |
|---|---|
| PubChem CID | 15222422 |
| Molecular Formula | C21H39BO3 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.30 |
| IUPAC Name | (3S,4R,5S)-5-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]-4-methylhexan-3-ol |
| SMILES | CC[C@H](O)[C@H](C)[C@H](C)B1O[C@H](C2CCCCC2)[C@@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C21H39BO3/c1-4-19(23)15(2)16(3)22-24-20(17-11-7-5-8-12-17)21(25-22)18-13-9-6-10-14-18/h15-21,23H,4-14H2,1-3H3/t15-,16+,19+,20-,21-/m1/s1 |
| InChIKey | VBHLAJWGGOVRFV-QFIDOLFYSA-N |
| XLogP | 5.22 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|