C19H34BClO2 — CID 73058008
(4R,5R)-2-[(1S)-1-chloro-3-methylbutyl]-4,5-dicyclohexyl-1,3,2-dioxaborolane (PubChem CID 73058008) has the molecular formula C19H34BClO2 and a molecular weight of 340.74 g/mol. Its IUPAC name is (4R,5R)-2-[(1S)-1-chloro-3-methylbutyl]-4,5-dicyclohexyl-1,3,2-dioxaborolane.
| Compound Name | (4R,5R)-2-[(1S)-1-chloro-3-methylbutyl]-4,5-dicyclohexyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 73058008 |
| Molecular Formula | C19H34BClO2 |
| Molecular Weight | 340.74 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | (4R,5R)-2-[(1S)-1-chloro-3-methylbutyl]-4,5-dicyclohexyl-1,3,2-dioxaborolane |
| SMILES | CC(C)C[C@@H](Cl)B1O[C@H](C2CCCCC2)[C@@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C19H34BClO2/c1-14(2)13-17(21)20-22-18(15-9-5-3-6-10-15)19(23-20)16-11-7-4-8-12-16/h14-19H,3-13H2,1-2H3/t17-,18-,19-/m1/s1 |
| InChIKey | GMSUOPAJISFTIF-GUDVDZBRSA-N |
| XLogP | 5.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.74 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|