C24H41BClNO2 — CID 135048452
(4S)-4-[(S)-chloro-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]methyl]-2-methyloctanenitrile (PubChem CID 135048452) has the molecular formula C24H41BClNO2 and a molecular weight of 421.86 g/mol. Its IUPAC name is (4S)-4-[(S)-chloro-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]methyl]-2-methyloctanenitrile.
| Compound Name | (4S)-4-[(S)-chloro-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]methyl]-2-methyloctanenitrile |
|---|---|
| PubChem CID | 135048452 |
| Molecular Formula | C24H41BClNO2 |
| Molecular Weight | 421.86 g/mol |
| Exact Mass | 421.29 |
| IUPAC Name | (4S)-4-[(S)-chloro-[(4R,5R)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]methyl]-2-methyloctanenitrile |
| SMILES | CCCC[C@@H](CC(C)C#N)[C@@H](Cl)B1O[C@H](C2CCCCC2)[C@@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C24H41BClNO2/c1-3-4-11-21(16-18(2)17-27)24(26)25-28-22(19-12-7-5-8-13-19)23(29-25)20-14-9-6-10-15-20/h18-24H,3-16H2,1-2H3/t18?,21-,22+,23+,24+/m0/s1 |
| InChIKey | YDXLNNWVCOTCES-KHCDCHQFSA-N |
| XLogP | 6.92 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.86 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|