C19H37BO3Si — CID 134903708
tert-butyl-[(E)-3-[(5S)-5-cyclohexyl-4,4-dimethyl-1,3,2-dioxaborolan-2-yl]prop-1-enoxy]-dimethylsilane (PubChem CID 134903708) has the molecular formula C19H37BO3Si and a molecular weight of 352.40 g/mol. Its IUPAC name is tert-butyl-[(E)-3-[(5S)-5-cyclohexyl-4,4-dimethyl-1,3,2-dioxaborolan-2-yl]prop-1-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-3-[(5S)-5-cyclohexyl-4,4-dimethyl-1,3,2-dioxaborolan-2-yl]prop-1-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134903708 |
| Molecular Formula | C19H37BO3Si |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | tert-butyl-[(E)-3-[(5S)-5-cyclohexyl-4,4-dimethyl-1,3,2-dioxaborolan-2-yl]prop-1-enoxy]-dimethylsilane |
| SMILES | CC1(C)OB(C/C=C/O[Si](C)(C)C(C)(C)C)O[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C19H37BO3Si/c1-18(2,3)24(6,7)21-15-11-14-20-22-17(19(4,5)23-20)16-12-9-8-10-13-16/h11,15-17H,8-10,12-14H2,1-7H3/b15-11+/t17-/m0/s1 |
| InChIKey | RSOOKIQXYSBVMX-JMPLCFMRSA-N |
| XLogP | 5.78 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|