C22H43BO3Si — CID 154712141
tert-butyl-dimethyl-[(1R)-2-[(1R)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enyl]cyclohexyl]oxysilane (PubChem CID 154712141) has the molecular formula C22H43BO3Si and a molecular weight of 394.48 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1R)-2-[(1R)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enyl]cyclohexyl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(1R)-2-[(1R)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enyl]cyclohexyl]oxysilane |
|---|---|
| PubChem CID | 154712141 |
| Molecular Formula | C22H43BO3Si |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | tert-butyl-dimethyl-[(1R)-2-[(1R)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enyl]cyclohexyl]oxysilane |
| SMILES | C=CC[C@@H](B1OC(C)(C)C(C)(C)O1)C1CCCC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H43BO3Si/c1-11-14-18(23-25-21(5,6)22(7,8)26-23)17-15-12-13-16-19(17)24-27(9,10)20(2,3)4/h11,17-19H,1,12-16H2,2-10H3/t17?,18-,19-/m1/s1 |
| InChIKey | BLRXIEJFSNWJDQ-OMKBGSMGSA-N |
| XLogP | 6.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|