C26H49BO3Si — CID 154712100
tert-butyl-dimethyl-[(1R,5R)-1-methyl-5-prop-1-en-2-yl-2-[(1R)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enyl]cyclohexyl]oxysilane (PubChem CID 154712100) has the molecular formula C26H49BO3Si and a molecular weight of 448.57 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1R,5R)-1-methyl-5-prop-1-en-2-yl-2-[(1R)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enyl]cyclohexyl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(1R,5R)-1-methyl-5-prop-1-en-2-yl-2-[(1R)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enyl]cyclohexyl]oxysilane |
|---|---|
| PubChem CID | 154712100 |
| Molecular Formula | C26H49BO3Si |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.35 |
| IUPAC Name | tert-butyl-dimethyl-[(1R,5R)-1-methyl-5-prop-1-en-2-yl-2-[(1R)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enyl]cyclohexyl]oxysilane |
| SMILES | C=CC[C@@H](B1OC(C)(C)C(C)(C)O1)C1CC[C@@H](C(=C)C)C[C@@]1(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H49BO3Si/c1-14-15-22(27-28-24(7,8)25(9,10)29-27)21-17-16-20(19(2)3)18-26(21,11)30-31(12,13)23(4,5)6/h14,20-22H,1-2,15-18H2,3-13H3/t20-,21?,22-,26-/m1/s1 |
| InChIKey | OVORTJONQBKTBW-VRMWFUSASA-N |
| XLogP | 7.80 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|