C26H49BO3Si — CID 154712425
tert-butyl-[[6,6-dimethyl-3-[(2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enyl]-3-bicyclo[3.1.1]heptanyl]oxy]-dimethylsilane (PubChem CID 154712425) has the molecular formula C26H49BO3Si and a molecular weight of 448.57 g/mol. Its IUPAC name is tert-butyl-[[6,6-dimethyl-3-[(2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enyl]-3-bicyclo[3.1.1]heptanyl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[6,6-dimethyl-3-[(2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enyl]-3-bicyclo[3.1.1]heptanyl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 154712425 |
| Molecular Formula | C26H49BO3Si |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.35 |
| IUPAC Name | tert-butyl-[[6,6-dimethyl-3-[(2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enyl]-3-bicyclo[3.1.1]heptanyl]oxy]-dimethylsilane |
| SMILES | C=CC[C@H](CC1(O[Si](C)(C)C(C)(C)C)CC2CC(C1)C2(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C26H49BO3Si/c1-13-14-21(27-28-24(7,8)25(9,10)29-27)18-26(30-31(11,12)22(2,3)4)16-19-15-20(17-26)23(19,5)6/h13,19-21H,1,14-18H2,2-12H3/t19?,20?,21-,26?/m1/s1 |
| InChIKey | BTQGDMJJQXJRJY-OXZUXWFGSA-N |
| XLogP | 7.63 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|