C17H31BO2Si — CID 102275573
trimethyl-[(2S)-2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]but-3-enyl]silane (PubChem CID 102275573) has the molecular formula C17H31BO2Si and a molecular weight of 306.33 g/mol. Its IUPAC name is trimethyl-[(2S)-2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]but-3-enyl]silane.
| Compound Name | trimethyl-[(2S)-2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]but-3-enyl]silane |
|---|---|
| PubChem CID | 102275573 |
| Molecular Formula | C17H31BO2Si |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | trimethyl-[(2S)-2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]but-3-enyl]silane |
| SMILES | C=C[C@@H](C[Si](C)(C)C)B1O[C@H]2C[C@H]3C[C@H](C3(C)C)[C@@]2(C)O1 |
| InChI | InChI=1S/C17H31BO2Si/c1-8-13(11-21(5,6)7)18-19-15-10-12-9-14(16(12,2)3)17(15,4)20-18/h8,12-15H,1,9-11H2,2-7H3/t12-,13+,14-,15+,17-/m1/s1 |
| InChIKey | GNSSYMOUZLVGMX-LBKYZSNHSA-N |
| XLogP | 4.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|