C18H28BF3O2 — CID 143689935
2,9,9-trimethyl-4-[(2R)-1,1,1-trifluorooct-7-en-2-yl]-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (PubChem CID 143689935) has the molecular formula C18H28BF3O2 and a molecular weight of 344.23 g/mol. Its IUPAC name is 2,9,9-trimethyl-4-[(2R)-1,1,1-trifluorooct-7-en-2-yl]-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane.
| Compound Name | 2,9,9-trimethyl-4-[(2R)-1,1,1-trifluorooct-7-en-2-yl]-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 143689935 |
| Molecular Formula | C18H28BF3O2 |
| Molecular Weight | 344.23 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 2,9,9-trimethyl-4-[(2R)-1,1,1-trifluorooct-7-en-2-yl]-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| SMILES | C=CCCCC[C@@H](B1OC2CC3CC(C3(C)C)C2(C)O1)C(F)(F)F |
| InChI | InChI=1S/C18H28BF3O2/c1-5-6-7-8-9-14(18(20,21)22)19-23-15-11-12-10-13(16(12,2)3)17(15,4)24-19/h5,12-15H,1,6-11H2,2-4H3/t12?,13?,14-,15?,17?/m1/s1 |
| InChIKey | UQCAAAITQKMFED-IZUSSWBTSA-N |
| XLogP | 5.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.23 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|