C15H23BO2 — CID 134854886
(1S,2S,6R,8S)-2,9,9-trimethyl-4-[(1E)-3-methylbuta-1,3-dienyl]-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (PubChem CID 134854886) has the molecular formula C15H23BO2 and a molecular weight of 246.16 g/mol. Its IUPAC name is (1S,2S,6R,8S)-2,9,9-trimethyl-4-[(1E)-3-methylbuta-1,3-dienyl]-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane.
| Compound Name | (1S,2S,6R,8S)-2,9,9-trimethyl-4-[(1E)-3-methylbuta-1,3-dienyl]-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 134854886 |
| Molecular Formula | C15H23BO2 |
| Molecular Weight | 246.16 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | (1S,2S,6R,8S)-2,9,9-trimethyl-4-[(1E)-3-methylbuta-1,3-dienyl]-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| SMILES | C=C(C)/C=C/B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C15H23BO2/c1-10(2)6-7-16-17-13-9-11-8-12(14(11,3)4)15(13,5)18-16/h6-7,11-13H,1,8-9H2,2-5H3/b7-6+/t11-,12-,13+,15-/m0/s1 |
| InChIKey | QPQDQFDGBPFILS-ABQVJDGPSA-N |
| XLogP | 3.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.16 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|