C14H23BO2 — CID 135060035
(1R,2R,6S,8R)-4-[(2S)-but-3-en-2-yl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (PubChem CID 135060035) has the molecular formula C14H23BO2 and a molecular weight of 234.15 g/mol. Its IUPAC name is (1R,2R,6S,8R)-4-[(2S)-but-3-en-2-yl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane.
| Compound Name | (1R,2R,6S,8R)-4-[(2S)-but-3-en-2-yl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 135060035 |
| Molecular Formula | C14H23BO2 |
| Molecular Weight | 234.15 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | (1R,2R,6S,8R)-4-[(2S)-but-3-en-2-yl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| SMILES | C=C[C@H](C)B1O[C@H]2C[C@H]3C[C@H](C3(C)C)[C@@]2(C)O1 |
| InChI | InChI=1S/C14H23BO2/c1-6-9(2)15-16-12-8-10-7-11(13(10,3)4)14(12,5)17-15/h6,9-12H,1,7-8H2,2-5H3/t9-,10+,11+,12-,14+/m0/s1 |
| InChIKey | VIKOLKJSIOQVFK-ILOGHGLZSA-N |
| XLogP | 3.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.15 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|