C13H21BO2 — CID 162419880
(6R,8R)-2,9,9-trimethyl-4-prop-2-enyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (PubChem CID 162419880) has the molecular formula C13H21BO2 and a molecular weight of 220.12 g/mol. Its IUPAC name is (6R,8R)-2,9,9-trimethyl-4-prop-2-enyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane.
| Compound Name | (6R,8R)-2,9,9-trimethyl-4-prop-2-enyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 162419880 |
| Molecular Formula | C13H21BO2 |
| Molecular Weight | 220.12 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | (6R,8R)-2,9,9-trimethyl-4-prop-2-enyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| SMILES | C=CCB1O[C@@H]2C[C@H]3CC(C3(C)C)C2(C)O1 |
| InChI | InChI=1S/C13H21BO2/c1-5-6-14-15-11-8-9-7-10(12(9,2)3)13(11,4)16-14/h5,9-11H,1,6-8H2,2-4H3/t9-,10?,11-,13?/m1/s1 |
| InChIKey | ZWEMLWHNKCNXMY-YLXHPXFOSA-N |
| XLogP | 2.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.12 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|