C14H21BO2 — CID 134903570
(1S,2S,8S)-4-buta-1,3-dien-2-yl-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (PubChem CID 134903570) has the molecular formula C14H21BO2 and a molecular weight of 232.13 g/mol. Its IUPAC name is (1S,2S,8S)-4-buta-1,3-dien-2-yl-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane.
| Compound Name | (1S,2S,8S)-4-buta-1,3-dien-2-yl-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 134903570 |
| Molecular Formula | C14H21BO2 |
| Molecular Weight | 232.13 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | (1S,2S,8S)-4-buta-1,3-dien-2-yl-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| SMILES | C=CC(=C)B1OC2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C14H21BO2/c1-6-9(2)15-16-12-8-10-7-11(13(10,3)4)14(12,5)17-15/h6,10-12H,1-2,7-8H2,3-5H3/t10-,11-,12?,14-/m0/s1 |
| InChIKey | FKWLAZYOURLXEG-XYXXDAQMSA-N |
| XLogP | 3.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.13 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|