C17H29BO2 — CID 135048141
(1S,2S,6R,8S)-4-[(3S)-hept-1-en-3-yl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (PubChem CID 135048141) has the molecular formula C17H29BO2 and a molecular weight of 276.23 g/mol. Its IUPAC name is (1S,2S,6R,8S)-4-[(3S)-hept-1-en-3-yl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane.
| Compound Name | (1S,2S,6R,8S)-4-[(3S)-hept-1-en-3-yl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 135048141 |
| Molecular Formula | C17H29BO2 |
| Molecular Weight | 276.23 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | (1S,2S,6R,8S)-4-[(3S)-hept-1-en-3-yl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| SMILES | C=CC(CCCC)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C17H29BO2/c1-6-8-9-13(7-2)18-19-15-11-12-10-14(16(12,3)4)17(15,5)20-18/h7,12-15H,2,6,8-11H2,1,3-5H3/t12-,13?,14-,15+,17-/m0/s1 |
| InChIKey | WBAMOCRCNQADNN-LFLYSQGHSA-N |
| XLogP | 4.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.23 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|