C21H43BO3Si — CID 154711790
dimethyl-propan-2-yloxy-[(E)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-1-en-2-yl]silane (PubChem CID 154711790) has the molecular formula C21H43BO3Si and a molecular weight of 382.47 g/mol. Its IUPAC name is dimethyl-propan-2-yloxy-[(E)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-1-en-2-yl]silane.
| Compound Name | dimethyl-propan-2-yloxy-[(E)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-1-en-2-yl]silane |
|---|---|
| PubChem CID | 154711790 |
| Molecular Formula | C21H43BO3Si |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | dimethyl-propan-2-yloxy-[(E)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-1-en-2-yl]silane |
| SMILES | CCCCCCCC/C(=C\B1OC(C)(C)C(C)(C)O1)[Si](C)(C)OC(C)C |
| InChI | InChI=1S/C21H43BO3Si/c1-10-11-12-13-14-15-16-19(26(8,9)23-18(2)3)17-22-24-20(4,5)21(6,7)25-22/h17-18H,10-16H2,1-9H3/b19-17+ |
| InChIKey | CLOQDRWDCOAEIG-HTXNQAPBSA-N |
| XLogP | 6.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|