C28H57BO4Si2 — CID 134878857
tert-butyl-[(Z)-9-[tert-butyl(dimethyl)silyl]oxy-4-methylidene-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)non-5-enoxy]-dimethylsilane (PubChem CID 134878857) has the molecular formula C28H57BO4Si2 and a molecular weight of 524.74 g/mol. Its IUPAC name is tert-butyl-[(Z)-9-[tert-butyl(dimethyl)silyl]oxy-4-methylidene-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)non-5-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(Z)-9-[tert-butyl(dimethyl)silyl]oxy-4-methylidene-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)non-5-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134878857 |
| Molecular Formula | C28H57BO4Si2 |
| Molecular Weight | 524.74 g/mol |
| Exact Mass | 524.39 |
| IUPAC Name | tert-butyl-[(Z)-9-[tert-butyl(dimethyl)silyl]oxy-4-methylidene-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)non-5-enoxy]-dimethylsilane |
| SMILES | C=C(CCCO[Si](C)(C)C(C)(C)C)/C(=C\CCCO[Si](C)(C)C(C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C28H57BO4Si2/c1-23(19-18-22-31-35(14,15)26(5,6)7)24(29-32-27(8,9)28(10,11)33-29)20-16-17-21-30-34(12,13)25(2,3)4/h20H,1,16-19,21-22H2,2-15H3/b24-20+ |
| InChIKey | RKFSSWQEQUHVFM-HIXSDJFHSA-N |
| XLogP | 8.70 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.74 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|