C23H49BO4Si2 — CID 101499395
tert-butyl-[(E)-6-[dimethyl(propan-2-yloxy)silyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enoxy]-dimethylsilane (PubChem CID 101499395) has the molecular formula C23H49BO4Si2 and a molecular weight of 456.63 g/mol. Its IUPAC name is tert-butyl-[(E)-6-[dimethyl(propan-2-yloxy)silyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-6-[dimethyl(propan-2-yloxy)silyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 101499395 |
| Molecular Formula | C23H49BO4Si2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.33 |
| IUPAC Name | tert-butyl-[(E)-6-[dimethyl(propan-2-yloxy)silyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enoxy]-dimethylsilane |
| SMILES | CC(C)O[Si](C)(C)/C=C(/CCCCO[Si](C)(C)C(C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C23H49BO4Si2/c1-19(2)26-29(10,11)18-20(24-27-22(6,7)23(8,9)28-24)16-14-15-17-25-30(12,13)21(3,4)5/h18-19H,14-17H2,1-13H3/b20-18- |
| InChIKey | BONMCNFDVOMJPL-ZZEZOPTASA-N |
| XLogP | 6.91 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|