C25H47BO3Si — CID 138970959
tert-butyl-dimethyl-[(3S,4R,5E,7E,9E)-4,6,7-trimethyl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)deca-5,7,9-trien-3-yl]oxysilane (PubChem CID 138970959) has the molecular formula C25H47BO3Si and a molecular weight of 434.55 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3S,4R,5E,7E,9E)-4,6,7-trimethyl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)deca-5,7,9-trien-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3S,4R,5E,7E,9E)-4,6,7-trimethyl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)deca-5,7,9-trien-3-yl]oxysilane |
|---|---|
| PubChem CID | 138970959 |
| Molecular Formula | C25H47BO3Si |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.34 |
| IUPAC Name | tert-butyl-dimethyl-[(3S,4R,5E,7E,9E)-4,6,7-trimethyl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)deca-5,7,9-trien-3-yl]oxysilane |
| SMILES | CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C(C)/C(C)=C/C=C/B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C25H47BO3Si/c1-14-22(27-30(12,13)23(5,6)7)21(4)18-20(3)19(2)16-15-17-26-28-24(8,9)25(10,11)29-26/h15-18,21-22H,14H2,1-13H3/b17-15+,19-16+,20-18+/t21-,22+/m1/s1 |
| InChIKey | RSVPVJLHTXCKKJ-KFEYBMLASA-N |
| XLogP | 7.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|