C20H20O5 — CID 154712950
3-benzyl-3-tert-butylperoxychromene-2,4-dione (PubChem CID 154712950) has the molecular formula C20H20O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is 3-benzyl-3-tert-butylperoxychromene-2,4-dione.
| Compound Name | 3-benzyl-3-tert-butylperoxychromene-2,4-dione |
|---|---|
| PubChem CID | 154712950 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 3-benzyl-3-tert-butylperoxychromene-2,4-dione |
| SMILES | CC(C)(C)OOC1(Cc2ccccc2)C(=O)Oc2ccccc2C1=O |
| InChI | InChI=1S/C20H20O5/c1-19(2,3)24-25-20(13-14-9-5-4-6-10-14)17(21)15-11-7-8-12-16(15)23-18(20)22/h4-12H,13H2,1-3H3 |
| InChIKey | HWVMBRNFOUNYGD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|