C17H19ClO3 — CID 15266129
4-benzyl-4-tert-butylperoxy-2-chlorocyclohexa-2,5-dien-1-one (PubChem CID 15266129) has the molecular formula C17H19ClO3 and a molecular weight of 306.79 g/mol. Its IUPAC name is 4-benzyl-4-tert-butylperoxy-2-chlorocyclohexa-2,5-dien-1-one.
| Compound Name | 4-benzyl-4-tert-butylperoxy-2-chlorocyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 15266129 |
| Molecular Formula | C17H19ClO3 |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-benzyl-4-tert-butylperoxy-2-chlorocyclohexa-2,5-dien-1-one |
| SMILES | CC(C)(C)OOC1(Cc2ccccc2)C=CC(=O)C(Cl)=C1 |
| InChI | InChI=1S/C17H19ClO3/c1-16(2,3)20-21-17(10-9-15(19)14(18)12-17)11-13-7-5-4-6-8-13/h4-10,12H,11H2,1-3H3 |
| InChIKey | VMTDLVJDBCATKO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|