C18H30O4 — CID 139605327
3,3-bis(tert-butylperoxy)butylbenzene (PubChem CID 139605327) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is 3,3-bis(tert-butylperoxy)butylbenzene.
| Compound Name | 3,3-bis(tert-butylperoxy)butylbenzene |
|---|---|
| PubChem CID | 139605327 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 3,3-bis(tert-butylperoxy)butylbenzene |
| SMILES | CC(C)(C)OOC(C)(CCc1ccccc1)OOC(C)(C)C |
| InChI | InChI=1S/C18H30O4/c1-16(2,3)19-21-18(7,22-20-17(4,5)6)14-13-15-11-9-8-10-12-15/h8-12H,13-14H2,1-7H3 |
| InChIKey | KELOQXUHOHIFRY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|