C17H27NO5 — CID 71507360
tert-butyl N-[2-(1-tert-butylperoxy-4-oxocyclohexa-2,5-dien-1-yl)ethyl]carbamate (PubChem CID 71507360) has the molecular formula C17H27NO5 and a molecular weight of 325.41 g/mol. Its IUPAC name is tert-butyl N-[2-(1-tert-butylperoxy-4-oxocyclohexa-2,5-dien-1-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(1-tert-butylperoxy-4-oxocyclohexa-2,5-dien-1-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 71507360 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | tert-butyl N-[2-(1-tert-butylperoxy-4-oxocyclohexa-2,5-dien-1-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OOC1(CCNC(=O)OC(C)(C)C)C=CC(=O)C=C1 |
| InChI | InChI=1S/C17H27NO5/c1-15(2,3)21-14(20)18-12-11-17(23-22-16(4,5)6)9-7-13(19)8-10-17/h7-10H,11-12H2,1-6H3,(H,18,20) |
| InChIKey | PMVKJHMEGBRKMC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|