C11H21N5O2 — CID 152679791
tert-butyl N-[2-(2,4-diamino-1H-pyrimidin-4-yl)ethyl]carbamate (PubChem CID 152679791) has the molecular formula C11H21N5O2 and a molecular weight of 255.32 g/mol. Its IUPAC name is tert-butyl N-[2-(2,4-diamino-1H-pyrimidin-4-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2,4-diamino-1H-pyrimidin-4-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 152679791 |
| Molecular Formula | C11H21N5O2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | tert-butyl N-[2-(2,4-diamino-1H-pyrimidin-4-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC1(N)C=CNC(N)=N1 |
| InChI | InChI=1S/C11H21N5O2/c1-10(2,3)18-9(17)15-7-5-11(13)4-6-14-8(12)16-11/h4,6H,5,7,13H2,1-3H3,(H,15,17)(H3,12,14,16) |
| InChIKey | ZNHHQDAZMFFLEC-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |