C22H35NO5 — CID 134873886
[1-[9-[(2-methylpropan-2-yl)oxycarbonylamino]nonyl]-6-oxocyclohexa-2,4-dien-1-yl] acetate (PubChem CID 134873886) has the molecular formula C22H35NO5 and a molecular weight of 393.52 g/mol. Its IUPAC name is [1-[9-[(2-methylpropan-2-yl)oxycarbonylamino]nonyl]-6-oxocyclohexa-2,4-dien-1-yl] acetate.
| Compound Name | [1-[9-[(2-methylpropan-2-yl)oxycarbonylamino]nonyl]-6-oxocyclohexa-2,4-dien-1-yl] acetate |
|---|---|
| PubChem CID | 134873886 |
| Molecular Formula | C22H35NO5 |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | [1-[9-[(2-methylpropan-2-yl)oxycarbonylamino]nonyl]-6-oxocyclohexa-2,4-dien-1-yl] acetate |
| SMILES | CC(=O)OC1(CCCCCCCCCNC(=O)OC(C)(C)C)C=CC=CC1=O |
| InChI | InChI=1S/C22H35NO5/c1-18(24)27-22(16-12-10-14-19(22)25)15-11-8-6-5-7-9-13-17-23-20(26)28-21(2,3)4/h10,12,14,16H,5-9,11,13,15,17H2,1-4H3,(H,23,26) |
| InChIKey | JDGYBUIUAJMMEL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|