C19H28N2O3 — CID 162153155
tert-butyl N-[5-(cyclooctatetraenecarbonylamino)pentyl]carbamate (PubChem CID 162153155) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is tert-butyl N-[5-(cyclooctatetraenecarbonylamino)pentyl]carbamate.
| Compound Name | tert-butyl N-[5-(cyclooctatetraenecarbonylamino)pentyl]carbamate |
|---|---|
| PubChem CID | 162153155 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | tert-butyl N-[5-(cyclooctatetraenecarbonylamino)pentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCNC(=O)C1=C/C=C\C=C/C=C1 |
| InChI | InChI=1S/C19H28N2O3/c1-19(2,3)24-18(23)21-15-11-7-10-14-20-17(22)16-12-8-5-4-6-9-13-16/h4-6,8-9,12-13H,7,10-11,14-15H2,1-3H3,(H,20,22)(H,21,23)/b5-4-,6-4-,8-5-,9-6?,12-8?,13-9?,16-12?,16-13? |
| InChIKey | GQQQCJCIGKYDHV-GROXGJCGSA-N |
| XLogP | 3.41 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|